C22H23FO2 — CID 59504317
(4aR,10aS)-10-(3-fluoro-4-methoxyphenyl)-6-methoxy-1,2,3,4,4a,10a-hexahydrophenanthrene (PubChem CID 59504317) has the molecular formula C22H23FO2 and a molecular weight of 338.42 g/mol. Its IUPAC name is (4aR,10aS)-10-(3-fluoro-4-methoxyphenyl)-6-methoxy-1,2,3,4,4a,10a-hexahydrophenanthrene.
| Compound Name | (4aR,10aS)-10-(3-fluoro-4-methoxyphenyl)-6-methoxy-1,2,3,4,4a,10a-hexahydrophenanthrene |
|---|---|
| PubChem CID | 59504317 |
| Molecular Formula | C22H23FO2 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (4aR,10aS)-10-(3-fluoro-4-methoxyphenyl)-6-methoxy-1,2,3,4,4a,10a-hexahydrophenanthrene |
| SMILES | COc1ccc2c(c1)[C@@H]1CCCC[C@@H]1C(c1ccc(OC)c(F)c1)=C2 |
| InChI | InChI=1S/C22H23FO2/c1-24-16-9-7-14-11-19(15-8-10-22(25-2)21(23)12-15)17-5-3-4-6-18(17)20(14)13-16/h7-13,17-18H,3-6H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | KFMUANNRZLOVNJ-ZWKOTPCHSA-N |
| XLogP | 5.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|