C23H28O5 — CID 7357039
(4aR,6R,10bR)-6-(2,5-dimethoxyphenyl)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene (PubChem CID 7357039) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is (4aR,6R,10bR)-6-(2,5-dimethoxyphenyl)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene.
| Compound Name | (4aR,6R,10bR)-6-(2,5-dimethoxyphenyl)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene |
|---|---|
| PubChem CID | 7357039 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (4aR,6R,10bR)-6-(2,5-dimethoxyphenyl)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene |
| SMILES | COc1ccc(OC)c([C@@H]2O[C@@H]3CCCC[C@@H]3c3cc(OC)c(OC)cc32)c1 |
| InChI | InChI=1S/C23H28O5/c1-24-14-9-10-19(25-2)18(11-14)23-17-13-22(27-4)21(26-3)12-16(17)15-7-5-6-8-20(15)28-23/h9-13,15,20,23H,5-8H2,1-4H3/t15-,20-,23-/m1/s1 |
| InChIKey | HUVLGXCTVIMPTE-ZFUCPZCZSA-N |
| XLogP | 4.87 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |