C23H26O5 — CID 7359699
methyl 4-[(4aS,6S,10bS)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]benzoate (PubChem CID 7359699) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl 4-[(4aS,6S,10bS)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]benzoate.
| Compound Name | methyl 4-[(4aS,6S,10bS)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]benzoate |
|---|---|
| PubChem CID | 7359699 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | methyl 4-[(4aS,6S,10bS)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2O[C@H]3CCCC[C@H]3c3cc(OC)c(OC)cc32)cc1 |
| InChI | InChI=1S/C23H26O5/c1-25-20-12-17-16-6-4-5-7-19(16)28-22(18(17)13-21(20)26-2)14-8-10-15(11-9-14)23(24)27-3/h8-13,16,19,22H,4-7H2,1-3H3/t16-,19-,22-/m0/s1 |
| InChIKey | RRDRXWGBAPJIMR-BPXKWBHBSA-N |
| XLogP | 4.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |