C21H23FO3 — CID 11899610
(4aR,6S,10bR)-6-(3-fluorophenyl)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene (PubChem CID 11899610) has the molecular formula C21H23FO3 and a molecular weight of 342.41 g/mol. Its IUPAC name is (4aR,6S,10bR)-6-(3-fluorophenyl)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene.
| Compound Name | (4aR,6S,10bR)-6-(3-fluorophenyl)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene |
|---|---|
| PubChem CID | 11899610 |
| Molecular Formula | C21H23FO3 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (4aR,6S,10bR)-6-(3-fluorophenyl)-8,9-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene |
| SMILES | COc1cc2c(cc1OC)[C@H]1CCCC[C@H]1O[C@H]2c1cccc(F)c1 |
| InChI | InChI=1S/C21H23FO3/c1-23-19-11-16-15-8-3-4-9-18(15)25-21(17(16)12-20(19)24-2)13-6-5-7-14(22)10-13/h5-7,10-12,15,18,21H,3-4,8-9H2,1-2H3/t15-,18-,21+/m1/s1 |
| InChIKey | XEZFXTLWFUBFTN-FPDPHYFHSA-N |
| XLogP | 4.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |