C20H24O4S — CID 7357398
(4R,5aR,9aS)-4-(3,4,5-trimethoxyphenyl)-5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromene (PubChem CID 7357398) has the molecular formula C20H24O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is (4R,5aR,9aS)-4-(3,4,5-trimethoxyphenyl)-5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromene.
| Compound Name | (4R,5aR,9aS)-4-(3,4,5-trimethoxyphenyl)-5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromene |
|---|---|
| PubChem CID | 7357398 |
| Molecular Formula | C20H24O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (4R,5aR,9aS)-4-(3,4,5-trimethoxyphenyl)-5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromene |
| SMILES | COc1cc([C@H]2O[C@@H]3CCCC[C@@H]3c3sccc32)cc(OC)c1OC |
| InChI | InChI=1S/C20H24O4S/c1-21-16-10-12(11-17(22-2)19(16)23-3)18-14-8-9-25-20(14)13-6-4-5-7-15(13)24-18/h8-11,13,15,18H,4-7H2,1-3H3/t13-,15+,18+/m0/s1 |
| InChIKey | MKYPUXHLVJDKEN-JCKWVBRZSA-N |
| XLogP | 4.92 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |