C19H22O2S — CID 98683032
(4S,5aS,9aS)-4-(4-methoxyphenyl)-2-methyl-5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromene (PubChem CID 98683032) has the molecular formula C19H22O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is (4S,5aS,9aS)-4-(4-methoxyphenyl)-2-methyl-5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromene.
| Compound Name | (4S,5aS,9aS)-4-(4-methoxyphenyl)-2-methyl-5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromene |
|---|---|
| PubChem CID | 98683032 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (4S,5aS,9aS)-4-(4-methoxyphenyl)-2-methyl-5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromene |
| SMILES | COc1ccc([C@@H]2O[C@H]3CCCC[C@@H]3c3sc(C)cc32)cc1 |
| InChI | InChI=1S/C19H22O2S/c1-12-11-16-18(13-7-9-14(20-2)10-8-13)21-17-6-4-3-5-15(17)19(16)22-12/h7-11,15,17-18H,3-6H2,1-2H3/t15-,17-,18-/m0/s1 |
| InChIKey | ZOQNJVDNPLBKAE-SZMVWBNQSA-N |
| XLogP | 5.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |