C15H20O2 — CID 11207019
(2R,3R)-2-cyclohexyl-3-(4-methoxyphenyl)oxirane (PubChem CID 11207019) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (2R,3R)-2-cyclohexyl-3-(4-methoxyphenyl)oxirane.
| Compound Name | (2R,3R)-2-cyclohexyl-3-(4-methoxyphenyl)oxirane |
|---|---|
| PubChem CID | 11207019 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2R,3R)-2-cyclohexyl-3-(4-methoxyphenyl)oxirane |
| SMILES | COc1ccc([C@H]2O[C@@H]2C2CCCCC2)cc1 |
| InChI | InChI=1S/C15H20O2/c1-16-13-9-7-12(8-10-13)15-14(17-15)11-5-3-2-4-6-11/h7-11,14-15H,2-6H2,1H3/t14-,15-/m1/s1 |
| InChIKey | JHIJYBXWWLYNOL-HUUCEWRRSA-N |
| XLogP | 3.72 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|