C11H13BrO3 — CID 162408429
(2R,3R)-2-bromo-3-(4-methoxyphenyl)-1,4-dioxane (PubChem CID 162408429) has the molecular formula C11H13BrO3 and a molecular weight of 273.13 g/mol. Its IUPAC name is (2R,3R)-2-bromo-3-(4-methoxyphenyl)-1,4-dioxane.
| Compound Name | (2R,3R)-2-bromo-3-(4-methoxyphenyl)-1,4-dioxane |
|---|---|
| PubChem CID | 162408429 |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | (2R,3R)-2-bromo-3-(4-methoxyphenyl)-1,4-dioxane |
| SMILES | COc1ccc([C@H]2OCCO[C@@H]2Br)cc1 |
| InChI | InChI=1S/C11H13BrO3/c1-13-9-4-2-8(3-5-9)10-11(12)15-7-6-14-10/h2-5,10-11H,6-7H2,1H3/t10-,11+/m1/s1 |
| InChIKey | FUTKNSVGSQSUEU-MNOVXSKESA-N |
| XLogP | 2.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|