C19H20O4 — CID 11716583
(2R,3R)-2,3-bis(4-methoxyphenyl)-5-methylidene-1,4-dioxane (PubChem CID 11716583) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(4-methoxyphenyl)-5-methylidene-1,4-dioxane.
| Compound Name | (2R,3R)-2,3-bis(4-methoxyphenyl)-5-methylidene-1,4-dioxane |
|---|---|
| PubChem CID | 11716583 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (2R,3R)-2,3-bis(4-methoxyphenyl)-5-methylidene-1,4-dioxane |
| SMILES | C=C1CO[C@H](c2ccc(OC)cc2)[C@@H](c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C19H20O4/c1-13-12-22-18(14-4-8-16(20-2)9-5-14)19(23-13)15-6-10-17(21-3)11-7-15/h4-11,18-19H,1,12H2,2-3H3/t18-,19-/m1/s1 |
| InChIKey | OUNGIWSBIIYCPR-RTBURBONSA-N |
| XLogP | 4.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |