C16H20O3 — CID 11521764
(2R,3S)-2-(4-methoxyphenyl)-4-methylidene-3-(prop-2-enoxymethyl)oxolane (PubChem CID 11521764) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2R,3S)-2-(4-methoxyphenyl)-4-methylidene-3-(prop-2-enoxymethyl)oxolane.
| Compound Name | (2R,3S)-2-(4-methoxyphenyl)-4-methylidene-3-(prop-2-enoxymethyl)oxolane |
|---|---|
| PubChem CID | 11521764 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2R,3S)-2-(4-methoxyphenyl)-4-methylidene-3-(prop-2-enoxymethyl)oxolane |
| SMILES | C=CCOC[C@@H]1C(=C)CO[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H20O3/c1-4-9-18-11-15-12(2)10-19-16(15)13-5-7-14(17-3)8-6-13/h4-8,15-16H,1-2,9-11H2,3H3/t15-,16+/m1/s1 |
| InChIKey | AEPPJZYIKYHNSE-CVEARBPZSA-N |
| XLogP | 3.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|