C12H14O3 — CID 18704700
2-(4-methoxyphenyl)-5-methylidene-1,3-dioxane (PubChem CID 18704700) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-methylidene-1,3-dioxane.
| Compound Name | 2-(4-methoxyphenyl)-5-methylidene-1,3-dioxane |
|---|---|
| PubChem CID | 18704700 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-methylidene-1,3-dioxane |
| SMILES | C=C1COC(c2ccc(OC)cc2)OC1 |
| InChI | InChI=1S/C12H14O3/c1-9-7-14-12(15-8-9)10-3-5-11(13-2)6-4-10/h3-6,12H,1,7-8H2,2H3 |
| InChIKey | DCNCOGWFMIGXSA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|