C13H14O3 — CID 101402507
(4S,5S)-5-(4-methoxyphenyl)-4-methyl-3-methylideneoxolan-2-one (PubChem CID 101402507) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (4S,5S)-5-(4-methoxyphenyl)-4-methyl-3-methylideneoxolan-2-one.
| Compound Name | (4S,5S)-5-(4-methoxyphenyl)-4-methyl-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 101402507 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (4S,5S)-5-(4-methoxyphenyl)-4-methyl-3-methylideneoxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](c2ccc(OC)cc2)[C@H]1C |
| InChI | InChI=1S/C13H14O3/c1-8-9(2)13(14)16-12(8)10-4-6-11(15-3)7-5-10/h4-8,12H,2H2,1,3H3/t8-,12-/m0/s1 |
| InChIKey | JROMYRDSGVZCRC-UFBFGSQYSA-N |
| XLogP | 2.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|