C13H18O3 — CID 56986398
4-(4-methoxyphenyl)-2,2,5-trimethyl-1,3-dioxolane (PubChem CID 56986398) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,2,5-trimethyl-1,3-dioxolane.
| Compound Name | 4-(4-methoxyphenyl)-2,2,5-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 56986398 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,2,5-trimethyl-1,3-dioxolane |
| SMILES | COc1ccc(C2OC(C)(C)OC2C)cc1 |
| InChI | InChI=1S/C13H18O3/c1-9-12(16-13(2,3)15-9)10-5-7-11(14-4)8-6-10/h5-9,12H,1-4H3 |
| InChIKey | KTBQXFKJAMUNDT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |