C14H20O3 — CID 13085354
(2R,4R,5S,6R)-4-(4-methoxyphenyl)-2,5,6-trimethyl-1,3-dioxane (PubChem CID 13085354) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2R,4R,5S,6R)-4-(4-methoxyphenyl)-2,5,6-trimethyl-1,3-dioxane.
| Compound Name | (2R,4R,5S,6R)-4-(4-methoxyphenyl)-2,5,6-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 13085354 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2R,4R,5S,6R)-4-(4-methoxyphenyl)-2,5,6-trimethyl-1,3-dioxane |
| SMILES | COc1ccc([C@@H]2O[C@H](C)O[C@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C14H20O3/c1-9-10(2)16-11(3)17-14(9)12-5-7-13(15-4)8-6-12/h5-11,14H,1-4H3/t9-,10+,11+,14+/m0/s1 |
| InChIKey | ZDMGWDQCVVCDCP-ICUOPCATSA-N |
| XLogP | 3.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |