C11H10O2 — CID 135891777
(2S,3R)-2-ethynyl-3-(4-methoxyphenyl)oxirane (PubChem CID 135891777) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is (2S,3R)-2-ethynyl-3-(4-methoxyphenyl)oxirane.
| Compound Name | (2S,3R)-2-ethynyl-3-(4-methoxyphenyl)oxirane |
|---|---|
| PubChem CID | 135891777 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (2S,3R)-2-ethynyl-3-(4-methoxyphenyl)oxirane |
| SMILES | C#C[C@@H]1O[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H10O2/c1-3-10-11(13-10)8-4-6-9(12-2)7-5-8/h1,4-7,10-11H,2H3/t10-,11+/m0/s1 |
| InChIKey | JPLFQYGTVZILRG-WDEREUQCSA-N |
| XLogP | 1.77 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|