C13H16O2 — CID 15473511
(2R,3R)-2-(4-methoxyphenyl)-3-(2-methylprop-1-enyl)oxirane (PubChem CID 15473511) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2R,3R)-2-(4-methoxyphenyl)-3-(2-methylprop-1-enyl)oxirane.
| Compound Name | (2R,3R)-2-(4-methoxyphenyl)-3-(2-methylprop-1-enyl)oxirane |
|---|---|
| PubChem CID | 15473511 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2R,3R)-2-(4-methoxyphenyl)-3-(2-methylprop-1-enyl)oxirane |
| SMILES | COc1ccc([C@H]2O[C@@H]2C=C(C)C)cc1 |
| InChI | InChI=1S/C13H16O2/c1-9(2)8-12-13(15-12)10-4-6-11(14-3)7-5-10/h4-8,12-13H,1-3H3/t12-,13-/m1/s1 |
| InChIKey | RODZMWIOQKAHEY-CHWSQXEVSA-N |
| XLogP | 3.10 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|