C10H9KO4 — CID 23702120
potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate (PubChem CID 23702120) has the molecular formula C10H9KO4 and a molecular weight of 232.28 g/mol. Its IUPAC name is potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate.
| Compound Name | potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 23702120 |
| Molecular Formula | C10H9KO4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate |
| SMILES | COc1ccc([C@@H]2O[C@@H]2C(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C10H10O4.K/c1-13-7-4-2-6(3-5-7)8-9(14-8)10(11)12;/h2-5,8-9H,1H3,(H,11,12);/q;+1/p-1/t8-,9-;/m0./s1 |
| InChIKey | DIDPCMPMOKVSDK-OZZZDHQUSA-M |
| XLogP | -3.11 |
| TPSA | 61.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|