potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate

C10H9KO4 — CID 23702120

IUPACpotassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate
SMILESCOc1ccc([C@@H]2O[C@@H]2C(=O)[O-])cc1.[K+]
InChIInChI=1S/C10H10O4.K/c1-13-7-4-2-6(3-5-7)8-9(14-8)10(11)12;/h2-5,8-9H,1H3,(H,11,12);/q;+1/p-1/t8-,9-;/m0./s1
InChIKeyDIDPCMPMOKVSDK-OZZZDHQUSA-M
MW232.28 g/mol
LogP-3.11
Rot. Bonds3

About potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate

potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate (PubChem CID 23702120) has the molecular formula C10H9KO4 and a molecular weight of 232.28 g/mol. Its IUPAC name is potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate.

Molecular Properties

Compound Namepotassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate
PubChem CID23702120
Molecular FormulaC10H9KO4
Molecular Weight232.28 g/mol
Exact Mass232.01
IUPAC Namepotassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate
SMILESCOc1ccc([C@@H]2O[C@@H]2C(=O)[O-])cc1.[K+]
InChIInChI=1S/C10H10O4.K/c1-13-7-4-2-6(3-5-7)8-9(14-8)10(11)12;/h2-5,8-9H,1H3,(H,11,12);/q;+1/p-1/t8-,9-;/m0./s1
InChIKeyDIDPCMPMOKVSDK-OZZZDHQUSA-M
XLogP-3.11
TPSA61.89 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.28
LogP ≤ 5-3.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate?
The IUPAC name of potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate (CID 23702120) is potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate.
What is the SMILES notation for potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate?
The canonical SMILES for potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate is COc1ccc([C@@H]2O[C@@H]2C(=O)[O-])cc1.[K+].
What is the InChIKey of potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate?
The InChIKey is DIDPCMPMOKVSDK-OZZZDHQUSA-M. The full InChI is InChI=1S/C10H10O4.K/c1-13-7-4-2-6(3-5-7)8-9(14-8)10(11)12;/h2-5,8-9H,1H3,(H,11,12);/q;+1/p-1/t8-,9-;/m0./s1.
What are the key properties of potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate?
potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate has a molecular weight of 232.28 g/mol, XLogP of -3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate is sourced from PubChem (CID 23702120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).