C13H16O4 — CID 11107343
propan-2-yl (2R,3R)-3-(4-methoxyphenyl)oxirane-2-carboxylate (PubChem CID 11107343) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is propan-2-yl (2R,3R)-3-(4-methoxyphenyl)oxirane-2-carboxylate.
| Compound Name | propan-2-yl (2R,3R)-3-(4-methoxyphenyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 11107343 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | propan-2-yl (2R,3R)-3-(4-methoxyphenyl)oxirane-2-carboxylate |
| SMILES | COc1ccc([C@H]2O[C@H]2C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C13H16O4/c1-8(2)16-13(14)12-11(17-12)9-4-6-10(15-3)7-5-9/h4-8,11-12H,1-3H3/t11-,12-/m1/s1 |
| InChIKey | LCUBSKINEQWSPL-VXGBXAGGSA-N |
| XLogP | 2.09 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|