C20H24O3 — CID 14681590
2,5-bis(4-methoxyphenyl)-3,4-dimethyloxolane (PubChem CID 14681590) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2,5-bis(4-methoxyphenyl)-3,4-dimethyloxolane.
| Compound Name | 2,5-bis(4-methoxyphenyl)-3,4-dimethyloxolane |
|---|---|
| PubChem CID | 14681590 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2,5-bis(4-methoxyphenyl)-3,4-dimethyloxolane |
| SMILES | COc1ccc(C2OC(c3ccc(OC)cc3)C(C)C2C)cc1 |
| InChI | InChI=1S/C20H24O3/c1-13-14(2)20(16-7-11-18(22-4)12-8-16)23-19(13)15-5-9-17(21-3)10-6-15/h5-14,19-20H,1-4H3 |
| InChIKey | NBWJFYJZGGMCPP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |