C15H13ClO2 — CID 101333877
(2S,3S)-2-(4-chlorophenyl)-3-(4-methoxyphenyl)oxirane (PubChem CID 101333877) has the molecular formula C15H13ClO2 and a molecular weight of 260.72 g/mol. Its IUPAC name is (2S,3S)-2-(4-chlorophenyl)-3-(4-methoxyphenyl)oxirane.
| Compound Name | (2S,3S)-2-(4-chlorophenyl)-3-(4-methoxyphenyl)oxirane |
|---|---|
| PubChem CID | 101333877 |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (2S,3S)-2-(4-chlorophenyl)-3-(4-methoxyphenyl)oxirane |
| SMILES | COc1ccc([C@@H]2O[C@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H13ClO2/c1-17-13-8-4-11(5-9-13)15-14(18-15)10-2-6-12(16)7-3-10/h2-9,14-15H,1H3/t14-,15-/m0/s1 |
| InChIKey | RQEOSDUSBSOBML-GJZGRUSLSA-N |
| XLogP | 4.16 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|