About anisole;1,4-dichlorobenzene
anisole;1,4-dichlorobenzene (PubChem CID 175517246) has the molecular formula C13H12Cl2O
and a molecular weight of 255.14 g/mol. Its IUPAC name is anisole;1,4-dichlorobenzene.
Molecular Properties
| Compound Name | anisole;1,4-dichlorobenzene |
| PubChem CID | 175517246 |
| Molecular Formula | C13H12Cl2O |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | anisole;1,4-dichlorobenzene |
| SMILES | COc1ccccc1.Clc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H8O.C6H4Cl2/c1-8-7-5-3-2-4-6-7;7-5-1-2-6(8)4-3-5/h2-6H,1H3;1-4H |
| InChIKey | DIIOAUJBPOMEJN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze anisole;1,4-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;1,4-dichlorobenzene?
The IUPAC name of anisole;1,4-dichlorobenzene (CID 175517246) is anisole;1,4-dichlorobenzene.
What is the SMILES notation for anisole;1,4-dichlorobenzene?
The canonical SMILES for anisole;1,4-dichlorobenzene is COc1ccccc1.Clc1ccc(Cl)cc1.
What is the InChIKey of anisole;1,4-dichlorobenzene?
The InChIKey is DIIOAUJBPOMEJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H4Cl2/c1-8-7-5-3-2-4-6-7;7-5-1-2-6(8)4-3-5/h2-6H,1H3;1-4H.
What are the key properties of anisole;1,4-dichlorobenzene?
anisole;1,4-dichlorobenzene has a molecular weight of 255.14 g/mol, XLogP of 4.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;1,4-dichlorobenzene is sourced from PubChem (CID 175517246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).