C25H20ClNO — CID 20734414
N-(4-chlorophenyl)-N-(4-methoxyphenyl)-4-phenylaniline (PubChem CID 20734414) has the molecular formula C25H20ClNO and a molecular weight of 385.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-(4-methoxyphenyl)-4-phenylaniline.
| Compound Name | N-(4-chlorophenyl)-N-(4-methoxyphenyl)-4-phenylaniline |
|---|---|
| PubChem CID | 20734414 |
| Molecular Formula | C25H20ClNO |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-(4-chlorophenyl)-N-(4-methoxyphenyl)-4-phenylaniline |
| SMILES | COc1ccc(N(c2ccc(Cl)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H20ClNO/c1-28-25-17-15-24(16-18-25)27(23-13-9-21(26)10-14-23)22-11-7-20(8-12-22)19-5-3-2-4-6-19/h2-18H,1H3 |
| InChIKey | DVBQDLJMCYAPBS-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |