C32H32O5 — CID 139093397
(2S,3R,4R,5S)-3,4-bis(2-methoxyphenyl)-2,5-bis(4-methoxyphenyl)oxolane (PubChem CID 139093397) has the molecular formula C32H32O5 and a molecular weight of 496.60 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3,4-bis(2-methoxyphenyl)-2,5-bis(4-methoxyphenyl)oxolane.
| Compound Name | (2S,3R,4R,5S)-3,4-bis(2-methoxyphenyl)-2,5-bis(4-methoxyphenyl)oxolane |
|---|---|
| PubChem CID | 139093397 |
| Molecular Formula | C32H32O5 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (2S,3R,4R,5S)-3,4-bis(2-methoxyphenyl)-2,5-bis(4-methoxyphenyl)oxolane |
| SMILES | COc1ccc([C@H]2O[C@H](c3ccc(OC)cc3)[C@@H](c3ccccc3OC)[C@@H]2c2ccccc2OC)cc1 |
| InChI | InChI=1S/C32H32O5/c1-33-23-17-13-21(14-18-23)31-29(25-9-5-7-11-27(25)35-3)30(26-10-6-8-12-28(26)36-4)32(37-31)22-15-19-24(34-2)20-16-22/h5-20,29-32H,1-4H3/t29-,30-,31+,32+/m0/s1 |
| InChIKey | ARYGEZGCMGEJJL-GASGPIRDSA-N |
| XLogP | 7.10 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |