C13H18O3 — CID 102589589
(2S,3R,4S,5S)-5-(4-methoxyphenyl)-2,4-dimethyloxolan-3-ol (PubChem CID 102589589) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (2S,3R,4S,5S)-5-(4-methoxyphenyl)-2,4-dimethyloxolan-3-ol.
| Compound Name | (2S,3R,4S,5S)-5-(4-methoxyphenyl)-2,4-dimethyloxolan-3-ol |
|---|---|
| PubChem CID | 102589589 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2S,3R,4S,5S)-5-(4-methoxyphenyl)-2,4-dimethyloxolan-3-ol |
| SMILES | COc1ccc([C@H]2O[C@@H](C)[C@H](O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C13H18O3/c1-8-12(14)9(2)16-13(8)10-4-6-11(15-3)7-5-10/h4-9,12-14H,1-3H3/t8-,9-,12+,13-/m0/s1 |
| InChIKey | HTXOLGLMCILCJG-NGERZBJRSA-N |
| XLogP | 2.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |