C14H20O5S — CID 155883007
(2S,3S,4R,5S,6S)-2-[(4-methoxyphenyl)methylsulfanyl]-6-methyloxane-3,4,5-triol (PubChem CID 155883007) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-2-[(4-methoxyphenyl)methylsulfanyl]-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6S)-2-[(4-methoxyphenyl)methylsulfanyl]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 155883007 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (2S,3S,4R,5S,6S)-2-[(4-methoxyphenyl)methylsulfanyl]-6-methyloxane-3,4,5-triol |
| SMILES | COc1ccc(CS[C@@H]2O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C14H20O5S/c1-8-11(15)12(16)13(17)14(19-8)20-7-9-3-5-10(18-2)6-4-9/h3-6,8,11-17H,7H2,1-2H3/t8-,11+,12+,13-,14-/m0/s1 |
| InChIKey | CIPLAAUZHBURTB-DITHVHIGSA-N |
| XLogP | 0.76 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |