C15H20O7 — CID 163027894
1-(4-methoxyphenyl)-2-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethanone (PubChem CID 163027894) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethanone.
| Compound Name | 1-(4-methoxyphenyl)-2-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethanone |
|---|---|
| PubChem CID | 163027894 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethanone |
| SMILES | COc1ccc(C(=O)CO[C@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C15H20O7/c1-8-12(17)13(18)14(19)15(22-8)21-7-11(16)9-3-5-10(20-2)6-4-9/h3-6,8,12-15,17-19H,7H2,1-2H3/t8-,12-,13+,14+,15-/m0/s1 |
| InChIKey | BZQNNZLRPDYICZ-PASQLDBJSA-N |
| XLogP | -0.28 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |