C16H22O9 — CID 56983973
1-(3,5-dimethoxyphenyl)-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethanone (PubChem CID 56983973) has the molecular formula C16H22O9 and a molecular weight of 358.34 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethanone.
| Compound Name | 1-(3,5-dimethoxyphenyl)-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethanone |
|---|---|
| PubChem CID | 56983973 |
| Molecular Formula | C16H22O9 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethanone |
| SMILES | COc1cc(OC)cc(C(=O)CO[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C16H22O9/c1-22-9-3-8(4-10(5-9)23-2)11(18)7-24-16-15(21)14(20)13(19)12(6-17)25-16/h3-5,12-17,19-21H,6-7H2,1-2H3/t12-,13+,14+,15-,16-/m1/s1 |
| InChIKey | CLFMQXMUJGGZTQ-LYYZXLFJSA-N |
| XLogP | -1.30 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |