C20H22O10 — CID 102522871
[2-hydroxy-4-methoxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-(4-hydroxyphenyl)methanone (PubChem CID 102522871) has the molecular formula C20H22O10 and a molecular weight of 422.39 g/mol. Its IUPAC name is [2-hydroxy-4-methoxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-(4-hydroxyphenyl)methanone.
| Compound Name | [2-hydroxy-4-methoxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 102522871 |
| Molecular Formula | C20H22O10 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | [2-hydroxy-4-methoxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-(4-hydroxyphenyl)methanone |
| SMILES | COc1cc(O)c(C(=O)c2ccc(O)cc2)c(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C20H22O10/c1-28-11-6-12(23)15(16(24)9-2-4-10(22)5-3-9)13(7-11)29-20-19(27)18(26)17(25)14(8-21)30-20/h2-7,14,17-23,25-27H,8H2,1H3/t14-,17-,18+,19-,20+/m1/s1 |
| InChIKey | LCZPALDWQFYTCU-QSWMPLQWSA-N |
| XLogP | -0.48 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |