C19H20O9 — CID 42636397
[2,4-dihydroxy-6-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-(4-hydroxyphenyl)methanone (PubChem CID 42636397) has the molecular formula C19H20O9 and a molecular weight of 392.36 g/mol. Its IUPAC name is [2,4-dihydroxy-6-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-(4-hydroxyphenyl)methanone.
| Compound Name | [2,4-dihydroxy-6-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 42636397 |
| Molecular Formula | C19H20O9 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [2,4-dihydroxy-6-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-(4-hydroxyphenyl)methanone |
| SMILES | C[C@@H]1O[C@@H](Oc2cc(O)cc(O)c2C(=O)c2ccc(O)cc2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H20O9/c1-8-15(23)17(25)18(26)19(27-8)28-13-7-11(21)6-12(22)14(13)16(24)9-2-4-10(20)5-3-9/h2-8,15,17-23,25-26H,1H3/t8-,15-,17+,18+,19-/m0/s1 |
| InChIKey | BDUFDLBIUJUAJE-KONKAKAUSA-N |
| XLogP | 0.24 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |