C22H22O9 — CID 162881615
7-hydroxy-2-(4-hydroxyphenyl)-3-methyl-5-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one (PubChem CID 162881615) has the molecular formula C22H22O9 and a molecular weight of 430.41 g/mol. Its IUPAC name is 7-hydroxy-2-(4-hydroxyphenyl)-3-methyl-5-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one.
| Compound Name | 7-hydroxy-2-(4-hydroxyphenyl)-3-methyl-5-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 162881615 |
| Molecular Formula | C22H22O9 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 7-hydroxy-2-(4-hydroxyphenyl)-3-methyl-5-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
| SMILES | Cc1c(-c2ccc(O)cc2)oc2cc(O)cc(O[C@@H]3O[C@@H](C)[C@H](O)[C@H](O)[C@@H]3O)c2c1=O |
| InChI | InChI=1S/C22H22O9/c1-9-17(25)16-14(30-21(9)11-3-5-12(23)6-4-11)7-13(24)8-15(16)31-22-20(28)19(27)18(26)10(2)29-22/h3-8,10,18-20,22-24,26-28H,1-2H3/t10-,18-,19-,20-,22-/m0/s1 |
| InChIKey | YKPKNHFJZZQJQU-LNVVTOCRSA-N |
| XLogP | 1.39 |
| TPSA | 149.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |