C26H28O15 — CID 162969133
2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one (PubChem CID 162969133) has the molecular formula C26H28O15 and a molecular weight of 580.50 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 162969133 |
| Molecular Formula | C26H28O15 |
| Molecular Weight | 580.50 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one |
| SMILES | C[C@@H]1O[C@H](Oc2cc(O)cc3oc(-c4ccc(O)c(O)c4)c(O[C@@H]4OC[C@@H](O)[C@H](O)[C@H]4O)c(=O)c23)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H28O15/c1-8-17(31)20(34)22(36)26(38-8)40-15-6-10(27)5-14-16(15)19(33)24(41-25-21(35)18(32)13(30)7-37-25)23(39-14)9-2-3-11(28)12(29)4-9/h2-6,8,13,17-18,20-22,25-32,34-36H,7H2,1H3/t8-,13+,17-,18-,20+,21+,22+,25-,26+/m0/s1 |
| InChIKey | INNUNJJEUMGPKR-VMKLVEHXSA-N |
| XLogP | -1.40 |
| TPSA | 249.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.50 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|