C22H24O10 — CID 155073683
(E)-3-(3,5-dihydroxy-2-methylphenoxy)-3-(4-hydroxyphenyl)-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyprop-2-enal (PubChem CID 155073683) has the molecular formula C22H24O10 and a molecular weight of 448.42 g/mol. Its IUPAC name is (E)-3-(3,5-dihydroxy-2-methylphenoxy)-3-(4-hydroxyphenyl)-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyprop-2-enal.
| Compound Name | (E)-3-(3,5-dihydroxy-2-methylphenoxy)-3-(4-hydroxyphenyl)-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyprop-2-enal |
|---|---|
| PubChem CID | 155073683 |
| Molecular Formula | C22H24O10 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (E)-3-(3,5-dihydroxy-2-methylphenoxy)-3-(4-hydroxyphenyl)-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyprop-2-enal |
| SMILES | Cc1c(O)cc(O)cc1O/C(=C(\C=O)OC1OC(C)C(O)C(O)C1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H24O10/c1-10-15(26)7-14(25)8-16(10)31-21(12-3-5-13(24)6-4-12)17(9-23)32-22-20(29)19(28)18(27)11(2)30-22/h3-9,11,18-20,22,24-29H,1-2H3/b21-17+ |
| InChIKey | MLXPGENCPBMSNN-HEHNFIMWSA-N |
| XLogP | 0.90 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|