C38H40Cl4O4 — CID 139065834
(2R,3R,5S,6S)-2,6-bis(4-chlorophenyl)-3,5-dimethyloxan-4-ol (PubChem CID 139065834) has the molecular formula C38H40Cl4O4 and a molecular weight of 702.55 g/mol. Its IUPAC name is (2R,3R,5S,6S)-2,6-bis(4-chlorophenyl)-3,5-dimethyloxan-4-ol.
| Compound Name | (2R,3R,5S,6S)-2,6-bis(4-chlorophenyl)-3,5-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 139065834 |
| Molecular Formula | C38H40Cl4O4 |
| Molecular Weight | 702.55 g/mol |
| Exact Mass | 700.17 |
| IUPAC Name | (2R,3R,5S,6S)-2,6-bis(4-chlorophenyl)-3,5-dimethyloxan-4-ol |
| SMILES | C[C@@H]1C(O)[C@H](C)[C@@H](c2ccc(Cl)cc2)O[C@H]1c1ccc(Cl)cc1.C[C@@H]1C(O)[C@H](C)[C@@H](c2ccc(Cl)cc2)O[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/2C19H20Cl2O2/c2*1-11-17(22)12(2)19(14-5-9-16(21)10-6-14)23-18(11)13-3-7-15(20)8-4-13/h2*3-12,17-19,22H,1-2H3/t2*11-,12+,17?,18-,19+ |
| InChIKey | SEYDANHEDKIZEG-BXZQGCLBSA-N |
| XLogP | 10.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.55 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |