C10H9ClO2 — CID 101197056
1-[(2R,3S)-3-(4-chlorophenyl)oxiran-2-yl]ethanone (PubChem CID 101197056) has the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. Its IUPAC name is 1-[(2R,3S)-3-(4-chlorophenyl)oxiran-2-yl]ethanone.
| Compound Name | 1-[(2R,3S)-3-(4-chlorophenyl)oxiran-2-yl]ethanone |
|---|---|
| PubChem CID | 101197056 |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 1-[(2R,3S)-3-(4-chlorophenyl)oxiran-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1O[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H9ClO2/c1-6(12)9-10(13-9)7-2-4-8(11)5-3-7/h2-5,9-10H,1H3/t9-,10-/m0/s1 |
| InChIKey | AFZGEZWDLUFGQN-UWVGGRQHSA-N |
| XLogP | 2.37 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|