C11H9ClO4S — CID 10730924
methyl 5-(4-chlorophenyl)-2-sulfanylidene-1,3-dioxolane-4-carboxylate (PubChem CID 10730924) has the molecular formula C11H9ClO4S and a molecular weight of 272.71 g/mol. Its IUPAC name is methyl 5-(4-chlorophenyl)-2-sulfanylidene-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl 5-(4-chlorophenyl)-2-sulfanylidene-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 10730924 |
| Molecular Formula | C11H9ClO4S |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | methyl 5-(4-chlorophenyl)-2-sulfanylidene-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)C1OC(=S)OC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H9ClO4S/c1-14-10(13)9-8(15-11(17)16-9)6-2-4-7(12)5-3-6/h2-5,8-9H,1H3 |
| InChIKey | HSAQLTZKXCCKBL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|