C14H15ClO8S2 — CID 6976360
dimethyl (4R,6R)-5-(4-chlorophenyl)-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate (PubChem CID 6976360) has the molecular formula C14H15ClO8S2 and a molecular weight of 410.85 g/mol. Its IUPAC name is dimethyl (4R,6R)-5-(4-chlorophenyl)-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate.
| Compound Name | dimethyl (4R,6R)-5-(4-chlorophenyl)-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate |
|---|---|
| PubChem CID | 6976360 |
| Molecular Formula | C14H15ClO8S2 |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | dimethyl (4R,6R)-5-(4-chlorophenyl)-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1C(c2ccc(Cl)cc2)[C@H](C(=O)OC)S(=O)(=O)CS1(=O)=O |
| InChI | InChI=1S/C14H15ClO8S2/c1-22-13(16)11-10(8-3-5-9(15)6-4-8)12(14(17)23-2)25(20,21)7-24(11,18)19/h3-6,10-12H,7H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | TYXVKAYTMAVUHG-VXGBXAGGSA-N |
| XLogP | 0.31 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |