C16H18ClNO6 — CID 102044379
trimethyl (2S,3S,4S,5R)-5-(4-chlorophenyl)pyrrolidine-2,3,4-tricarboxylate (PubChem CID 102044379) has the molecular formula C16H18ClNO6 and a molecular weight of 355.77 g/mol. Its IUPAC name is trimethyl (2S,3S,4S,5R)-5-(4-chlorophenyl)pyrrolidine-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2S,3S,4S,5R)-5-(4-chlorophenyl)pyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 102044379 |
| Molecular Formula | C16H18ClNO6 |
| Molecular Weight | 355.77 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | trimethyl (2S,3S,4S,5R)-5-(4-chlorophenyl)pyrrolidine-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C(=O)OC)[C@H](c2ccc(Cl)cc2)N[C@@H]1C(=O)OC |
| InChI | InChI=1S/C16H18ClNO6/c1-22-14(19)10-11(15(20)23-2)13(16(21)24-3)18-12(10)8-4-6-9(17)7-5-8/h4-7,10-13,18H,1-3H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | NENBBOPDCJHIGZ-CYDGBPFRSA-N |
| XLogP | 1.10 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.77 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|