C23H21BrClNO4 — CID 134954030
methyl (1S,3R,3aS,5R,6aR)-5-[(3-bromophenyl)methyl]-1-(4-chlorophenyl)-5-methyl-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylate (PubChem CID 134954030) has the molecular formula C23H21BrClNO4 and a molecular weight of 490.78 g/mol. Its IUPAC name is methyl (1S,3R,3aS,5R,6aR)-5-[(3-bromophenyl)methyl]-1-(4-chlorophenyl)-5-methyl-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3R,3aS,5R,6aR)-5-[(3-bromophenyl)methyl]-1-(4-chlorophenyl)-5-methyl-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134954030 |
| Molecular Formula | C23H21BrClNO4 |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | methyl (1S,3R,3aS,5R,6aR)-5-[(3-bromophenyl)methyl]-1-(4-chlorophenyl)-5-methyl-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1N[C@H](c2ccc(Cl)cc2)[C@@H]2C(=O)[C@@](C)(Cc3cccc(Br)c3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C23H21BrClNO4/c1-23(11-12-4-3-5-14(24)10-12)20(27)16-17(21(23)28)19(22(29)30-2)26-18(16)13-6-8-15(25)9-7-13/h3-10,16-19,26H,11H2,1-2H3/t16-,17+,18-,19-,23-/m1/s1 |
| InChIKey | KGPHHXDGCKWWBY-MXBGAEMTSA-N |
| XLogP | 3.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|