C22H20ClN3O5 — CID 132543773
methyl (2R,3R,4S,5S)-5-(4-chlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylpyrrolidine-2-carboxylate (PubChem CID 132543773) has the molecular formula C22H20ClN3O5 and a molecular weight of 441.87 g/mol. Its IUPAC name is methyl (2R,3R,4S,5S)-5-(4-chlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,3R,4S,5S)-5-(4-chlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 132543773 |
| Molecular Formula | C22H20ClN3O5 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | methyl (2R,3R,4S,5S)-5-(4-chlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1N[C@H](c2ccc(Cl)cc2)[C@@H](c2onc(C)c2[N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H20ClN3O5/c1-12-20(26(28)29)21(31-25-12)17-16(13-6-4-3-5-7-13)19(22(27)30-2)24-18(17)14-8-10-15(23)11-9-14/h3-11,16-19,24H,1-2H3/t16-,17-,18+,19+/m0/s1 |
| InChIKey | XJBHUMTXFQOCRX-INDMIFKZSA-N |
| XLogP | 4.30 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|