C20H22N2O5 — CID 102319428
methyl (2R,3R,4S,5S)-3-(4-methoxyphenyl)-5-(4-methylphenyl)-4-nitropyrrolidine-2-carboxylate (PubChem CID 102319428) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl (2R,3R,4S,5S)-3-(4-methoxyphenyl)-5-(4-methylphenyl)-4-nitropyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,3R,4S,5S)-3-(4-methoxyphenyl)-5-(4-methylphenyl)-4-nitropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102319428 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | methyl (2R,3R,4S,5S)-3-(4-methoxyphenyl)-5-(4-methylphenyl)-4-nitropyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1N[C@@H](c2ccc(C)cc2)[C@@H]([N+](=O)[O-])[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-12-4-6-14(7-5-12)17-19(22(24)25)16(18(21-17)20(23)27-3)13-8-10-15(26-2)11-9-13/h4-11,16-19,21H,1-3H3/t16-,17+,18-,19+/m1/s1 |
| InChIKey | WIHRSOGKGLPXQZ-HCXYKTFWSA-N |
| XLogP | 2.62 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|