C17H24N2O4 — CID 134943790
methyl (2S,3R,4S,5R)-4-nitro-3-pentyl-5-phenylpyrrolidine-2-carboxylate (PubChem CID 134943790) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl (2S,3R,4S,5R)-4-nitro-3-pentyl-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5R)-4-nitro-3-pentyl-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134943790 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | methyl (2S,3R,4S,5R)-4-nitro-3-pentyl-5-phenylpyrrolidine-2-carboxylate |
| SMILES | CCCCC[C@H]1[C@H]([N+](=O)[O-])[C@@H](c2ccccc2)N[C@@H]1C(=O)OC |
| InChI | InChI=1S/C17H24N2O4/c1-3-4-6-11-13-15(17(20)23-2)18-14(16(13)19(21)22)12-9-7-5-8-10-12/h5,7-10,13-16,18H,3-4,6,11H2,1-2H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | WWISFJAIVBYTCL-WCVJEAGWSA-N |
| XLogP | 2.71 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|