C21H24N2O4 — CID 135027204
tert-butyl (2R,3S,4S,5R)-4-nitro-3,5-diphenylpyrrolidine-2-carboxylate (PubChem CID 135027204) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is tert-butyl (2R,3S,4S,5R)-4-nitro-3,5-diphenylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R,3S,4S,5R)-4-nitro-3,5-diphenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 135027204 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | tert-butyl (2R,3S,4S,5R)-4-nitro-3,5-diphenylpyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1N[C@H](c2ccccc2)[C@@H]([N+](=O)[O-])[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H24N2O4/c1-21(2,3)27-20(24)18-16(14-10-6-4-7-11-14)19(23(25)26)17(22-18)15-12-8-5-9-13-15/h4-13,16-19,22H,1-3H3/t16-,17+,18+,19-/m0/s1 |
| InChIKey | BXUUPIJGWMMHTD-MANSERQUSA-N |
| XLogP | 3.47 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|