C20H30N2O6 — CID 140859143
tert-butyl (2S,3R,4S,5S)-5-(2-methoxyphenyl)-3-(2-methoxypropan-2-yl)-4-nitropyrrolidine-2-carboxylate (PubChem CID 140859143) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is tert-butyl (2S,3R,4S,5S)-5-(2-methoxyphenyl)-3-(2-methoxypropan-2-yl)-4-nitropyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S,3R,4S,5S)-5-(2-methoxyphenyl)-3-(2-methoxypropan-2-yl)-4-nitropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 140859143 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | tert-butyl (2S,3R,4S,5S)-5-(2-methoxyphenyl)-3-(2-methoxypropan-2-yl)-4-nitropyrrolidine-2-carboxylate |
| SMILES | COc1ccccc1[C@@H]1N[C@H](C(=O)OC(C)(C)C)[C@@H](C(C)(C)OC)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C20H30N2O6/c1-19(2,3)28-18(23)16-14(20(4,5)27-7)17(22(24)25)15(21-16)12-10-8-9-11-13(12)26-6/h8-11,14-17,21H,1-7H3/t14-,15+,16+,17+/m1/s1 |
| InChIKey | LWBAHTPPIBMDNQ-QZWWFDLISA-N |
| XLogP | 2.74 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|