C18H17BrN2O4 — CID 132515210
methyl (2S,3S,4R,5S)-3-(3-bromophenyl)-4-nitro-5-phenylpyrrolidine-2-carboxylate (PubChem CID 132515210) has the molecular formula C18H17BrN2O4 and a molecular weight of 405.25 g/mol. Its IUPAC name is methyl (2S,3S,4R,5S)-3-(3-bromophenyl)-4-nitro-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5S)-3-(3-bromophenyl)-4-nitro-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 132515210 |
| Molecular Formula | C18H17BrN2O4 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | methyl (2S,3S,4R,5S)-3-(3-bromophenyl)-4-nitro-5-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2ccccc2)[C@H]([N+](=O)[O-])[C@H]1c1cccc(Br)c1 |
| InChI | InChI=1S/C18H17BrN2O4/c1-25-18(22)16-14(12-8-5-9-13(19)10-12)17(21(23)24)15(20-16)11-6-3-2-4-7-11/h2-10,14-17,20H,1H3/t14-,15-,16-,17+/m0/s1 |
| InChIKey | XLVUFEKXSZUQRP-LUKYLMHMSA-N |
| XLogP | 3.06 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|