C20H16BrN3O2 — CID 170946010
methyl 5-(3-bromophenyl)-4,4-dicyano-3-phenylpyrrolidine-2-carboxylate (PubChem CID 170946010) has the molecular formula C20H16BrN3O2 and a molecular weight of 410.27 g/mol. Its IUPAC name is methyl 5-(3-bromophenyl)-4,4-dicyano-3-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl 5-(3-bromophenyl)-4,4-dicyano-3-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 170946010 |
| Molecular Formula | C20H16BrN3O2 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | methyl 5-(3-bromophenyl)-4,4-dicyano-3-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1NC(c2cccc(Br)c2)C(C#N)(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C20H16BrN3O2/c1-26-19(25)17-16(13-6-3-2-4-7-13)20(11-22,12-23)18(24-17)14-8-5-9-15(21)10-14/h2-10,16-18,24H,1H3 |
| InChIKey | RJMQZBWGFNOGNT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |