C24H26ClNO6 — CID 102132887
4-O,4-O'-diethyl 2-O-methyl (2S,3S,5S)-3-(4-chlorophenyl)-5-phenylpyrrolidine-2,4,4-tricarboxylate (PubChem CID 102132887) has the molecular formula C24H26ClNO6 and a molecular weight of 459.93 g/mol. Its IUPAC name is 4-O,4-O'-diethyl 2-O-methyl (2S,3S,5S)-3-(4-chlorophenyl)-5-phenylpyrrolidine-2,4,4-tricarboxylate.
| Compound Name | 4-O,4-O'-diethyl 2-O-methyl (2S,3S,5S)-3-(4-chlorophenyl)-5-phenylpyrrolidine-2,4,4-tricarboxylate |
|---|---|
| PubChem CID | 102132887 |
| Molecular Formula | C24H26ClNO6 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 4-O,4-O'-diethyl 2-O-methyl (2S,3S,5S)-3-(4-chlorophenyl)-5-phenylpyrrolidine-2,4,4-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](c2ccc(Cl)cc2)[C@@H](C(=O)OC)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H26ClNO6/c1-4-31-22(28)24(23(29)32-5-2)18(15-11-13-17(25)14-12-15)19(21(27)30-3)26-20(24)16-9-7-6-8-10-16/h6-14,18-20,26H,4-5H2,1-3H3/t18-,19+,20+/m1/s1 |
| InChIKey | PSLWWXCVQWTQHJ-AABGKKOBSA-N |
| XLogP | 3.42 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|