C27H21ClN2O6 — CID 177399961
ethyl (2'R,3'R,5'S)-5'-(4-chlorophenyl)-3'-(3-nitrophenyl)-1,3-dioxospiro[indene-2,4'-pyrrolidine]-2'-carboxylate (PubChem CID 177399961) has the molecular formula C27H21ClN2O6 and a molecular weight of 504.93 g/mol. Its IUPAC name is ethyl (2'R,3'R,5'S)-5'-(4-chlorophenyl)-3'-(3-nitrophenyl)-1,3-dioxospiro[indene-2,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | ethyl (2'R,3'R,5'S)-5'-(4-chlorophenyl)-3'-(3-nitrophenyl)-1,3-dioxospiro[indene-2,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 177399961 |
| Molecular Formula | C27H21ClN2O6 |
| Molecular Weight | 504.93 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | ethyl (2'R,3'R,5'S)-5'-(4-chlorophenyl)-3'-(3-nitrophenyl)-1,3-dioxospiro[indene-2,4'-pyrrolidine]-2'-carboxylate |
| SMILES | CCOC(=O)[C@@H]1N[C@@H](c2ccc(Cl)cc2)C2(C(=O)c3ccccc3C2=O)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H21ClN2O6/c1-2-36-26(33)22-21(16-6-5-7-18(14-16)30(34)35)27(23(29-22)15-10-12-17(28)13-11-15)24(31)19-8-3-4-9-20(19)25(27)32/h3-14,21-23,29H,2H2,1H3/t21-,22+,23-/m0/s1 |
| InChIKey | OFBQIHCJNOFBNG-ZRBLBEILSA-N |
| XLogP | 4.67 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|