C28H20N2O8 — CID 102488804
ethyl (4S,5S)-5-(3-nitrophenyl)-4-(4-nitrophenyl)-1',3'-dioxospiro[cyclopentene-3,2'-indene]-1-carboxylate (PubChem CID 102488804) has the molecular formula C28H20N2O8 and a molecular weight of 512.47 g/mol. Its IUPAC name is ethyl (4S,5S)-5-(3-nitrophenyl)-4-(4-nitrophenyl)-1',3'-dioxospiro[cyclopentene-3,2'-indene]-1-carboxylate.
| Compound Name | ethyl (4S,5S)-5-(3-nitrophenyl)-4-(4-nitrophenyl)-1',3'-dioxospiro[cyclopentene-3,2'-indene]-1-carboxylate |
|---|---|
| PubChem CID | 102488804 |
| Molecular Formula | C28H20N2O8 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | ethyl (4S,5S)-5-(3-nitrophenyl)-4-(4-nitrophenyl)-1',3'-dioxospiro[cyclopentene-3,2'-indene]-1-carboxylate |
| SMILES | CCOC(=O)C1=CC2(C(=O)c3ccccc3C2=O)[C@H](c2ccc([N+](=O)[O-])cc2)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H20N2O8/c1-2-38-27(33)22-15-28(25(31)20-8-3-4-9-21(20)26(28)32)24(16-10-12-18(13-11-16)29(34)35)23(22)17-6-5-7-19(14-17)30(36)37/h3-15,23-24H,2H2,1H3/t23-,24+/m0/s1 |
| InChIKey | DAMQLYUVJWLFSE-BJKOFHAPSA-N |
| XLogP | 4.94 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|