C21H18N4O7S — CID 86746713
ethyl 6-methyl-3-(4-nitrobenzoyl)-4-(3-nitrophenyl)-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 86746713) has the molecular formula C21H18N4O7S and a molecular weight of 470.46 g/mol. Its IUPAC name is ethyl 6-methyl-3-(4-nitrobenzoyl)-4-(3-nitrophenyl)-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-methyl-3-(4-nitrobenzoyl)-4-(3-nitrophenyl)-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 86746713 |
| Molecular Formula | C21H18N4O7S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | ethyl 6-methyl-3-(4-nitrobenzoyl)-4-(3-nitrophenyl)-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)N(C(=O)c2ccc([N+](=O)[O-])cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18N4O7S/c1-3-32-20(27)17-12(2)22-21(33)23(18(17)14-5-4-6-16(11-14)25(30)31)19(26)13-7-9-15(10-8-13)24(28)29/h4-11,18H,3H2,1-2H3,(H,22,33) |
| InChIKey | HCLVTCROXZNAIU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|