C16H17N3O7 — CID 134852691
5-O-ethyl 3-O-methyl (4R)-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-3,5-dicarboxylate (PubChem CID 134852691) has the molecular formula C16H17N3O7 and a molecular weight of 363.33 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl (4R)-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl (4R)-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 134852691 |
| Molecular Formula | C16H17N3O7 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 5-O-ethyl 3-O-methyl (4R)-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)N(C(=O)OC)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H17N3O7/c1-4-26-14(20)12-9(2)17-15(21)18(16(22)25-3)13(12)10-6-5-7-11(8-10)19(23)24/h5-8,13H,4H2,1-3H3,(H,17,21)/t13-/m1/s1 |
| InChIKey | AUCGXNKHUKEAOR-CYBMUJFWSA-N |
| XLogP | 2.26 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|